* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-GLY-GLY-GLY-GLY-ALA-OH |
CAS: | 20347-80-2 |
English Synonyms: | H-GLY-GLY-GLY-GLY-ALA-OH |
MDL Number.: | MFCD00136580 |
H bond acceptor: | 11 |
H bond donor: | 6 |
Smile: | C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)CNC(=O)CN |
InChi: | InChI=1S/C11H19N5O6/c1-6(11(21)22)16-10(20)5-15-9(19)4-14-8(18)3-13-7(17)2-12/h6H,2-5,12H2,1H3,(H,13,17)(H,14,18)(H,15,19)(H,16,20)(H,21,22)/t6-/m0/s1 |
InChiKey: | InChIKey=NXVQLROTKQDHIA-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.