* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOCITRONELLENE |
| CAS: | 85006-04-8 |
| English Synonyms: | ISOCITRONELLENE |
| MDL Number.: | MFCD00145207 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C[C@H](CCC=C)C=C(C)C |
| InChi: | InChI=1S/C10H18/c1-5-6-7-10(4)8-9(2)3/h5,8,10H,1,6-7H2,2-4H3/t10-/m1/s1 |
| InChiKey: | InChIKey=FYZHLRMYDRUDES-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.