* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ A2 0067 |
| English Synonyms: | RARECHEM AQ A2 0067 |
| MDL Number.: | MFCD00161291 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)S(=O)(=O)N/N=C(\C)/C(C)(C)C |
| InChi: | InChI=1S/C13H20N2O2S/c1-10-6-8-12(9-7-10)18(16,17)15-14-11(2)13(3,4)5/h6-9,15H,1-5H3/b14-11+ |
| InChiKey: | InChIKey=XQTZKMXYGXHZMD-SDNWHVSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.