* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUTARIC ACID, [1,5-14C] |
| CAS: | 39579-69-6 |
| English Synonyms: | GLUTARIC ACID, [1,5-14C] |
| MDL Number.: | MFCD00189766 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C(C[14C](=O)O)C[14C](=O)O |
| InChi: | InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/i4+2,5+2 |
| InChiKey: | InChIKey=JFCQEDHGNNZCLN-MABBKULESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.