* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCERALDEHYDE [14C(U)] |
| English Synonyms: | GLYCERALDEHYDE [14C(U)] |
| MDL Number.: | MFCD00189767 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [14CH2]([14CH]([14CH]=O)O)O |
| InChi: | InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/i1+2,2+2,3+2 |
| InChiKey: | InChIKey=MNQZXJOMYWMBOU-FIXSIXJRSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.