* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-ARG-OH |
| English Synonyms: | Z-L-ALANYL-L-ARGININE ; CBZ-L-ALA-ARG ; Z-ALA-ARG-OH |
| MDL Number.: | MFCD00191051 |
| H bond acceptor: | 10 |
| H bond donor: | 6 |
| Smile: | C[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H25N5O5/c1-11(21-17(26)27-10-12-6-3-2-4-7-12)14(23)22-13(15(24)25)8-5-9-20-16(18)19/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,21,26)(H,22,23)(H,24,25)(H4,18,19,20)/t11-,13-/m0/s1 |
| InChiKey: | InChIKey=IAJCBRQYWHEYSN-AAEUAGOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.