* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-TYR-OH |
| CAS: | 13122-97-9 |
| English Synonyms: | Z-L-ALANYL-L-TYROSINE ; Z-ALA-TYR-OH |
| MDL Number.: | MFCD00191056 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C20H22N2O6/c1-13(21-20(27)28-12-15-5-3-2-4-6-15)18(24)22-17(19(25)26)11-14-7-9-16(23)10-8-14/h2-10,13,17,23H,11-12H2,1H3,(H,21,27)(H,22,24)(H,25,26)/t13-,17-/m0/s1 |
| InChiKey: | InChIKey=INPGUDNBCHNMDV-GUYCJALGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.