* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-MET-TYR-OH |
| English Synonyms: | Z-L-METHIONYL-L-TYROSINE ; Z-MET-TYR-OH |
| MDL Number.: | MFCD00191130 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CSCC[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C22H26N2O6S/c1-31-12-11-18(24-22(29)30-14-16-5-3-2-4-6-16)20(26)23-19(21(27)28)13-15-7-9-17(25)10-8-15/h2-10,18-19,25H,11-14H2,1H3,(H,23,26)(H,24,29)(H,27,28)/t18-,19-/m0/s1 |
| InChiKey: | InChIKey=IFISDOKVQUPZEM-OALUTQOASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.