* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL FB 0071 |
| English Synonyms: | RARECHEM AL FB 0071 |
| MDL Number.: | MFCD00205047 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)C(=O)/C=C/Sc2ccc(cc2)Cl |
| InChi: | InChI=1S/C16H13ClOS/c1-12-2-4-13(5-3-12)16(18)10-11-19-15-8-6-14(17)7-9-15/h2-11H,1H3/b11-10+ |
| InChiKey: | InChIKey=ZTGPZWDTGRKIBK-ZHACJKMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.