* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOGIBBERELLIN A7 |
English Synonyms: | ISOGIBBERELLIN A7 |
MDL Number.: | MFCD00213919 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C[C@]12[C@H]3[C@@H]([C@@]45CC[C@H](C4)CC[C@H]5C3=C[C@H]([C@@H]1O)OC2=O)C(=O)O |
InChi: | InChI=1S/C18H22O5/c1-17-12-9(6-11(14(17)19)23-16(17)22)10-3-2-8-4-5-18(10,7-8)13(12)15(20)21/h6,8,10-14,19H,2-5,7H2,1H3,(H,20,21)/t8-,10+,11-,12-,13-,14+,17+,18+/m1/s1 |
InChiKey: | InChIKey=MEOOBAYAOPENCE-DUERWNACSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.