* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-9H-PURINE |
| CAS: | 20427-22-9 |
| English Synonyms: | 9-METHYL-9H-PURINE ; 9H-PURINE, 9-METHYL- |
| MDL Number.: | MFCD00234187 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cn1cnc2c1ncnc2 |
| InChi: | InChI=1S/C6H6N4/c1-10-4-9-5-2-7-3-8-6(5)10/h2-4H,1H3 |
| InChiKey: | InChIKey=VRZWCYZJGUYTKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.