* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL-PTERIDIN-4-OL |
| English Synonyms: | 7-PHENYL-PTERIDIN-4-OL |
| MDL Number.: | MFCD00234772 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2cnc3c(n2)ncnc3O |
| InChi: | InChI=1S/C12H8N4O/c17-12-10-11(14-7-15-12)16-9(6-13-10)8-4-2-1-3-5-8/h1-7H,(H,14,15,16,17) |
| InChiKey: | InChIKey=CDPVXHVRRKILEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.