* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IFENPRODIL, [PHENYL-3H]- |
| English Synonyms: | IFENPRODIL, [PHENYL-3H]- |
| MDL Number.: | MFCD00235541 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [3H]C1=CC(=CC([3H])=C1O)C(O)C(C)N1CCC(CC2=CC=CC=C2)CC1 |
| InChi: | InChI=1S/C21H27NO2/c1-16(21(24)19-7-9-20(23)10-8-19)22-13-11-18(12-14-22)15-17-5-3-2-4-6-17/h2-10,16,18,21,23-24H,11-15H2,1H3/i9T,10T |
| InChiKey: | InChIKey=UYNVMODNBIQBMV-ZQRTVVFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.