* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-PRO-ARG-AMC 2HCL |
| CAS: | 546103-85-9 |
| English Synonyms: | H-PRO-ARG-AMC 2HCL |
| MDL Number.: | MFCD00238138 |
| H bond acceptor: | 10 |
| H bond donor: | 6 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]3CCCN3.Cl |
| InChi: | InChI=1S/C21H28N6O4.ClH/c1-12-10-18(28)31-17-11-13(6-7-14(12)17)26-20(30)16(5-3-9-25-21(22)23)27-19(29)15-4-2-8-24-15;/h6-7,10-11,15-16,24H,2-5,8-9H2,1H3,(H,26,30)(H,27,29)(H4,22,23,25);1H/t15-,16-;/m0./s1 |
| InChiKey: | InChIKey=NEXVGYOPHAPQQH-MOGJOVFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.