* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-ALA-LYS-OH |
| English Synonyms: | Z-ALA-ALA-LYS-OH |
| MDL Number.: | MFCD00238397 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C20H30N4O6/c1-13(18(26)24-16(19(27)28)10-6-7-11-21)22-17(25)14(2)23-20(29)30-12-15-8-4-3-5-9-15/h3-5,8-9,13-14,16H,6-7,10-12,21H2,1-2H3,(H,22,25)(H,23,29)(H,24,26)(H,27,28)/t13-,14-,16-/m0/s1 |
| InChiKey: | InChIKey=BWANLYWJLSVUPE-DZKIICNBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.