* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLU-LEU-OH DCHA |
| CAS: | 252253-22-8 |
| English Synonyms: | Z-GLU-LEU-OH DCHA |
| MDL Number.: | MFCD00238431 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)OCc1ccccc1.C1CCC(CC1)NC2CCCCC2 |
| InChi: | InChI=1S/C19H26N2O7.C12H23N/c1-12(2)10-15(18(25)26)20-17(24)14(8-9-16(22)23)21-19(27)28-11-13-6-4-3-5-7-13;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-7,12,14-15H,8-11H2,1-2H3,(H,20,24)(H,21,27)(H,22,23)(H,25,26);11-13H,1-10H2/t14-,15-;/m0./s1 |
| InChiKey: | InChIKey=UBRRLFLWPDAYBP-YYLIZZNMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.