* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ICI 174,864 |
CAS: | 89352-67-0 |
English Synonyms: | N,N-DIALLYL-TYR-AIB-AIB-PHE-LEU ; ICI 174,864 |
MDL Number.: | MFCD00239488 |
H bond acceptor: | 12 |
H bond donor: | 6 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)[C@H](Cc2ccc(cc2)O)N(CC=C)CC=C |
InChi: | InChI=1S/C38H53N5O7/c1-9-20-43(21-10-2)31(24-27-16-18-28(44)19-17-27)33(46)41-38(7,8)36(50)42-37(5,6)35(49)40-29(23-26-14-12-11-13-15-26)32(45)39-30(34(47)48)22-25(3)4/h9-19,25,29-31,44H,1-2,20-24H2,3-8H3,(H,39,45)(H,40,49)(H,41,46)(H,42,50)(H,47,48)/t29-,30-,31-/m0/s1 |
InChiKey: | InChIKey=XUWLAGNFLUARAN-CHQNGUEUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.