* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-IP004639 |
| English Synonyms: | ZERENEX ZX-IP004639 |
| MDL Number.: | MFCD00452234 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)N[C@H]2CS(=O)(=O)C[C@H]2O |
| InChi: | InChI=1S/C11H15NO3S/c1-8-2-4-9(5-3-8)12-10-6-16(14,15)7-11(10)13/h2-5,10-13H,6-7H2,1H3/t10-,11+/m0/s1 |
| InChiKey: | InChIKey=NPXUDFWMDMCZRH-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.