* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBUPROFEN R (-)[CARBOXYL-14C] |
English Synonyms: | IBUPROFEN R (-)[CARBOXYL-14C] ; R(-)-IBUPROFEN [CARBOXYL-14 C] |
MDL Number.: | MFCD00671138 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)Cc1ccc(cc1)[C@@H](C)[14C](=O)O |
InChi: | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1/i13+2 |
InChiKey: | InChIKey=HEFNNWSXXWATRW-QLCWYWOMSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.