* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024732 |
| English Synonyms: | VITAS-BB TBB024732 |
| MDL Number.: | MFCD00687560 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | OC1=CC=C(C=C1)C(=O)N\N=C\C1=NC=CC=C1 |
| InChi: | InChI=1S/C13H11N3O2/c17-12-6-4-10(5-7-12)13(18)16-15-9-11-3-1-2-8-14-11/h1-9,17H,(H,16,18)/b15-9+ |
| InChiKey: | InChIKey=VFAXIPWLNFNJFM-OQLLNIDSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.