* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYBUZOLE |
CAS: | 1492-02-0 |
English Synonyms: | GLYBUZOLE |
MDL Number.: | MFCD00724711 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)c1nnc(s1)NS(=O)(=O)c2ccccc2 |
InChi: | InChI=1S/C12H15N3O2S2/c1-12(2,3)10-13-14-11(18-10)15-19(16,17)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,14,15) |
InChiKey: | InChIKey=NMWQEPCLNXHPDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.