* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ESCULAMINE |
| CAS: | 2908-75-0 |
| English Synonyms: | ESCULAMINE |
| MDL Number.: | MFCD00731035 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | Cc1cc(=O)oc2c1cc(c(c2CN(CCO)CCO)O)O |
| InChi: | InChI=1S/C15H19NO6/c1-9-6-13(20)22-15-10(9)7-12(19)14(21)11(15)8-16(2-4-17)3-5-18/h6-7,17-19,21H,2-5,8H2,1H3 |
| InChiKey: | InChIKey=VQSXXDXNONIOGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.