* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | EMOLECULES 877543 |
CAS: | 3412-99-5 |
English Synonyms: | EMOLECULES 877543 |
MDL Number.: | MFCD00760212 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C(=CNc1cccc(c1)Cl)C(=O)OCC |
InChi: | InChI=1S/C14H16ClNO4/c1-3-19-13(17)12(14(18)20-4-2)9-16-11-7-5-6-10(15)8-11/h5-9,16H,3-4H2,1-2H3 |
InChiKey: | InChIKey=BPRVACYIWCWMTJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.