* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FARAMPATOR |
CAS: | 211735-76-1 |
English Synonyms: | FARAMPATOR |
MDL Number.: | MFCD00831010 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc2c(cc1C(=O)N3CCCCC3)non2 |
InChi: | InChI=1S/C12H13N3O2/c16-12(15-6-2-1-3-7-15)9-4-5-10-11(8-9)14-17-13-10/h4-5,8H,1-3,6-7H2 |
InChiKey: | InChIKey=XFVRBYKKGGDPAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.