* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1183718 |
English Synonyms: | FCHGROUP FCH1183718 |
MDL Number.: | MFCD00847117 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(=O)n(cc1Cl)CC(=O)O |
InChi: | InChI=1S/C7H6ClNO3/c8-5-1-2-6(10)9(3-5)4-7(11)12/h1-3H,4H2,(H,11,12) |
InChiKey: | InChIKey=DJLIZUVIYDKFBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.