* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | STRINOLINE |
| CAS: | 39862-58-3 |
| English Synonyms: | STRINOLINE ; 1,2,4-TRIAZINO[5,6-C]QUINOLINE |
| MDL Number.: | MFCD00859030 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)c3c(cn2)ncnn3 |
| InChi: | InChI=1S/C10H6N4/c1-2-4-8-7(3-1)10-9(5-11-8)12-6-13-14-10/h1-6H |
| InChiKey: | InChIKey=ARFYZKAYDRJATN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.