* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VIQUIDIL |
CAS: | 84-55-9 |
English Synonyms: | VIQUIDIL ; QUINICINE |
MDL Number.: | MFCD00864731 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)c(ccn2)C(=O)CCC3CCNCC3C=C |
InChi: | InChI=1S/C20H24N2O2/c1-3-14-13-21-10-8-15(14)4-7-20(23)17-9-11-22-19-6-5-16(24-2)12-18(17)19/h3,5-6,9,11-12,14-15,21H,1,4,7-8,10,13H2,2H3 |
InChiKey: | InChIKey=DKRSEIPLAZTSFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.