* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULFAMETOMIDINE |
| CAS: | 3772-76-7 |
| English Synonyms: | SULFAMETOMIDINE |
| MDL Number.: | MFCD00864979 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1nc(cc(n1)OC)NS(=O)(=O)c2ccc(cc2)N |
| InChi: | InChI=1S/C12H14N4O3S/c1-8-14-11(7-12(15-8)19-2)16-20(17,18)10-5-3-9(13)4-6-10/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChiKey: | InChIKey=QKLSCPPJEVXONT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.