* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULMEPRIDE |
| CAS: | 57479-88-6 |
| English Synonyms: | SULMEPRIDE |
| MDL Number.: | MFCD00865364 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CN1CCCC1CNC(=O)c2cc(ccc2OC)S(=O)(=O)N |
| InChi: | InChI=1S/C14H21N3O4S/c1-17-7-3-4-10(17)9-16-14(18)12-8-11(22(15,19)20)5-6-13(12)21-2/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,16,18)(H2,15,19,20) |
| InChiKey: | InChIKey=QCKAYJICSQJJCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.