* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SAPRISARTAN |
| CAS: | 146623-69-0 |
| English Synonyms: | SAPRISARTAN |
| MDL Number.: | MFCD00865832 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCc1nc(c(n1Cc2ccc3c(c2)c(c(o3)c4ccccc4NS(=O)(=O)C(F)(F)F)Br)C(=O)N)C5CC5 |
| InChi: | InChI=1S/C25H22BrF3N4O4S/c1-2-19-31-21(14-8-9-14)22(24(30)34)33(19)12-13-7-10-18-16(11-13)20(26)23(37-18)15-5-3-4-6-17(15)32-38(35,36)25(27,28)29/h3-7,10-11,14,32H,2,8-9,12H2,1H3,(H2,30,34) |
| InChiKey: | InChIKey=DUEWVPTZCSAMNB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.