* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SALAZOSULFAMIDE |
| CAS: | 139-56-0 |
| English Synonyms: | SALAZOSULFAMIDE |
| MDL Number.: | MFCD00866214 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | c1cc(ccc1/N=N/c2ccc(c(c2)C(=O)O)O)S(=O)(=O)N |
| InChi: | InChI=1S/C13H11N3O5S/c14-22(20,21)10-4-1-8(2-5-10)15-16-9-3-6-12(17)11(7-9)13(18)19/h1-7,17H,(H,18,19)(H2,14,20,21)/b16-15+ |
| InChiKey: | InChIKey=NBSRUZQXRUNPNY-FOCLMDBBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.