* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENAFTIC ACID |
CAS: | 27736-80-7 |
English Synonyms: | FENAFTIC ACID |
MDL Number.: | MFCD00867191 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CC)C(=O)C1C(C(CC2=C1C(=O)CC(C2)(C)C)c3ccccc3)C(=O)O |
InChi: | InChI=1S/C24H31NO4/c1-5-25(6-2)22(27)21-19-16(13-24(3,4)14-18(19)26)12-17(20(21)23(28)29)15-10-8-7-9-11-15/h7-11,17,20-21H,5-6,12-14H2,1-4H3,(H,28,29) |
InChiKey: | InChIKey=FUXLDXFRSJXUQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.