* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULISATIN |
| CAS: | 54935-03-4 |
| English Synonyms: | SULISATIN ; SULISATINE |
| MDL Number.: | MFCD00867638 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | Cc1cccc2c1NC(=O)C2(c3ccc(cc3)OS(=O)(=O)O)c4ccc(cc4)OS(=O)(=O)O |
| InChi: | InChI=1S/C21H17NO9S2/c1-13-3-2-4-18-19(13)22-20(23)21(18,14-5-9-16(10-6-14)30-32(24,25)26)15-7-11-17(12-8-15)31-33(27,28)29/h2-12H,1H3,(H,22,23)(H,24,25,26)(H,27,28,29) |
| InChiKey: | InChIKey=URNFTLVCQLRCMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.