* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULVERAPRIDE |
| CAS: | 73747-20-3 |
| English Synonyms: | SULVERAPRIDE |
| MDL Number.: | MFCD00867748 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CNS(=O)(=O)c1cc(c(c(c1)OC)OC)C(=O)NCC2CCCN2C |
| InChi: | InChI=1S/C16H25N3O5S/c1-17-25(21,22)12-8-13(15(24-4)14(9-12)23-3)16(20)18-10-11-6-5-7-19(11)2/h8-9,11,17H,5-7,10H2,1-4H3,(H,18,20) |
| InChiKey: | InChIKey=SODOSTUXGWHQII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.