* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULFORIDAZINE |
| CAS: | 14759-06-9 |
| English Synonyms: | SULFORIDAZINE |
| MDL Number.: | MFCD00867758 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CN1CCCCC1CCN2c3ccccc3Sc4c2cc(cc4)S(=O)(=O)C |
| InChi: | InChI=1S/C21H26N2O2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)26-21-11-10-17(15-19(21)23)27(2,24)25/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
| InChiKey: | InChIKey=FLGCRGJDQJIJAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.