* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIMETHISTERONE |
| CAS: | 79-64-1 |
| English Synonyms: | DIMETHISTERONE |
| MDL Number.: | MFCD00867870 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC#C[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H](C4=CC(=O)CC[C@]34C)C)C)O |
| InChi: | InChI=1S/C23H32O2/c1-5-9-23(25)12-8-19-17-13-15(2)20-14-16(24)6-10-21(20,3)18(17)7-11-22(19,23)4/h14-15,17-19,25H,6-8,10-13H2,1-4H3/t15-,17+,18-,19-,21+,22-,23-/m0/s1 |
| InChiKey: | InChIKey=LVHOURKCKUYIGK-RGUJTQARSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.