* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FENERITROL |
| CAS: | 15301-67-4 |
| English Synonyms: | FENERITROL |
| MDL Number.: | MFCD00868861 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCC(c1ccccc1)C(=O)OCC(COC(=O)C(CC)c2ccccc2)(COC(=O)C(CC)c3ccccc3)COC(=O)C(CC)c4ccccc4 |
| InChi: | InChI=1S/C45H52O8/c1-5-37(33-21-13-9-14-22-33)41(46)50-29-45(30-51-42(47)38(6-2)34-23-15-10-16-24-34,31-52-43(48)39(7-3)35-25-17-11-18-26-35)32-53-44(49)40(8-4)36-27-19-12-20-28-36/h9-28,37-40H,5-8,29-32H2,1-4H3 |
| InChiKey: | InChIKey=FNDSQXMSCAOERP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.