* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SALPROTOSIDE |
| CAS: | 33779-37-2 |
| English Synonyms: | SALPROTOSIDE |
| MDL Number.: | MFCD00868935 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | CCCO[C@H]1[C@@H](C(O[C@H]1C(COC(=O)c2ccccc2O)OC(=O)c3ccccc3O)OCC)O |
| InChi: | InChI=1S/C25H30O10/c1-3-13-32-22-20(28)25(31-4-2)35-21(22)19(34-24(30)16-10-6-8-12-18(16)27)14-33-23(29)15-9-5-7-11-17(15)26/h5-12,19-22,25-28H,3-4,13-14H2,1-2H3/t19?,20-,21-,22-,25?/m0/s1 |
| InChiKey: | InChIKey=VKRBJYIBLRSBNI-XZCKPTJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.