* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPICLAMINE |
| CAS: | 90243-97-3 |
| English Synonyms: | SPICLAMINE |
| MDL Number.: | MFCD00869026 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1[C@@H]2[C@H]3CCC(C3)[C@]24CCC(=N4)N5CCOCC5)Cl |
| InChi: | InChI=1S/C20H25ClN2O/c21-17-5-2-14(3-6-17)19-15-1-4-16(13-15)20(19)8-7-18(22-20)23-9-11-24-12-10-23/h2-3,5-6,15-16,19H,1,4,7-13H2/t15-,16-,19+,20+/m0/s1 |
| InChiKey: | InChIKey=KIYTZWUWLDEAMW-XAMWDVODSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.