* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GENTAMICIN C1A |
CAS: | 26098-04-4 |
English Synonyms: | GENTAMICIN C1A |
MDL Number.: | MFCD00869298 |
H bond acceptor: | 12 |
H bond donor: | 8 |
Smile: | C[C@]1(CO[C@H]([C@H]([C@@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H](CC[C@H](O3)CN)N)N)N)O |
InChi: | InChI=1S/C19H39N5O7/c1-19(27)7-28-18(13(26)16(19)24-2)31-15-11(23)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h8-18,24-27H,3-7,20-23H2,1-2H3/t8-,9+,10-,11+,12-,13-,14+,15-,16-,17+,18-,19+/m0/s1 |
InChiKey: | InChIKey=VEGXETMJINRLTH-JHODFQNSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.