* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GDP-L-FUCOSE |
CAS: | 15839-70-0 |
English Synonyms: | GDP-L-FUCOSE ; GDP-FUCOSE ; GDP-FUC |
MDL Number.: | MFCD00870977 |
H bond acceptor: | 20 |
H bond donor: | 9 |
Smile: | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)n3cnc4c3nc([nH]c4=O)N)O)O)O)O)O |
InChi: | InChI=1S/C16H25N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4-,5+,7+,8+,9+,10+,11-,14+,15+/m0/s1 |
InChiKey: | InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.