* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 57273 |
CAS: | 123942-04-1 |
English Synonyms: | WIN 57273 |
MDL Number.: | MFCD00881986 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(cc(n1)C)c2cc3c(cc2F)c(=O)c(cn3C4CC4)C(=O)O |
InChi: | InChI=1S/C20H17FN2O3/c1-10-5-12(6-11(2)22-10)14-8-18-15(7-17(14)21)19(24)16(20(25)26)9-23(18)13-3-4-13/h5-9,13H,3-4H2,1-2H3,(H,25,26) |
InChiKey: | InChIKey=FNKLCGHPPNAPBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.