* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-NONYL-PYRROLE-2,5-DIONE |
| CAS: | 20458-51-9 |
| English Synonyms: | 1-NONYL-PYRROLE-2,5-DIONE |
| MDL Number.: | MFCD00941275 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCCCCCCCN1C(=O)C=CC1=O |
| InChi: | InChI=1S/C13H21NO2/c1-2-3-4-5-6-7-8-11-14-12(15)9-10-13(14)16/h9-10H,2-8,11H2,1H3 |
| InChiKey: | InChIKey=UNJAMUMWPRRGHF-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.