* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-AMINO-3-BENZYL-4-HYDROXY-1H-[1,8]NAPHTHYRIDIN-2-ONE |
| CAS: | 120537-84-0 |
| English Synonyms: | 7-AMINO-3-BENZYL-4-HYDROXY-1H-[1,8]NAPHTHYRIDIN-2-ONE |
| MDL Number.: | MFCD01314301 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)Cc2c(c3ccc(nc3[nH]c2=O)N)O |
| InChi: | InChI=1S/C15H13N3O2/c16-12-7-6-10-13(19)11(15(20)18-14(10)17-12)8-9-4-2-1-3-5-9/h1-7H,8H2,(H4,16,17,18,19,20) |
| InChiKey: | InChIKey=GTAYWFRTLFRYEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.