* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024477 |
| English Synonyms: | VITAS-BB TBB024477 |
| MDL Number.: | MFCD01351534 |
| H bond acceptor: | 12 |
| H bond donor: | 2 |
| Smile: | CCN(CC)C(=O)C1=C(C)C(C(N)=O)=C(NC(=O)C2=CC(=CC(=C2)[N+]([O-])=O)[N+]([O-])=O)S1 |
| InChi: | InChI=1S/C18H19N5O7S/c1-4-21(5-2)18(26)14-9(3)13(15(19)24)17(31-14)20-16(25)10-6-11(22(27)28)8-12(7-10)23(29)30/h6-8H,4-5H2,1-3H3,(H2,19,24)(H,20,25) |
| InChiKey: | InChIKey=ULZLMIIENWLUME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.