* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHOCILLIN Y 2 |
CAS: | 38965-70-7 |
English Synonyms: | XANTHOCILLIN Y 2 |
MDL Number.: | MFCD01657087 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | [C-]#[N+]/C(=C\c1ccc(c(c1)O)O)/C(=C/c2ccc(c(c2)O)O)/[N+]#[C-] |
InChi: | InChI=1S/C18H12N2O4/c1-19-13(7-11-3-5-15(21)17(23)9-11)14(20-2)8-12-4-6-16(22)18(24)10-12/h3-10,21-24H/b13-7-,14-8- |
InChiKey: | InChIKey=ZKYALRSZGHMWMS-PVRNWPCDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.