* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLUOROBENZOTEPA |
| CAS: | 726-92-1 |
| English Synonyms: | FLUOROBENZOTEPA |
| MDL Number.: | MFCD01666929 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1C(=O)NP(=O)(N2CC2)N3CC3)F |
| InChi: | InChI=1S/C11H13FN3O2P/c12-10-3-1-9(2-4-10)11(16)13-18(17,14-5-6-14)15-7-8-15/h1-4H,5-8H2,(H,13,16,17) |
| InChiKey: | InChIKey=GDNAXBLBWKDNIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.