* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-O-METHYLRABELOMYCIN |
| CAS: | 117620-88-9 |
| English Synonyms: | 8-O-METHYLRABELOMYCIN |
| MDL Number.: | MFCD01668119 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC1(Cc2cc(c3c(c2C(=O)C1)C(=O)c4cccc(c4C3=O)OC)O)O |
| InChi: | InChI=1S/C20H16O6/c1-20(25)7-9-6-11(21)16-17(14(9)12(22)8-20)18(23)10-4-3-5-13(26-2)15(10)19(16)24/h3-6,21,25H,7-8H2,1-2H3 |
| InChiKey: | InChIKey=LQIPGPPZCXJWKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.