* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VERSICOLORINB |
CAS: | 4331-22-0 |
English Synonyms: | VERSICOLORINB |
MDL Number.: | MFCD01675151 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1c(cc(c2c1C(=O)c3cc4c(c(c3C2=O)O)[C@@H]5CCO[C@@H]5O4)O)O |
InChi: | InChI=1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h3-5,7,18-20,23H,1-2H2/t7-,18+/m0/s1 |
InChiKey: | InChIKey=BABJNKGTTYCTOO-ULCDLSAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.