* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FECAPENTAENE-14 |
| CAS: | 91379-15-6 |
| English Synonyms: | FECAPENTAENE-14 |
| MDL Number.: | MFCD01697735 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCC/C=C/C=C/C=C/C=C/C=C/OCC(CO)O |
| InChi: | InChI=1S/C17H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-20-16-17(19)15-18/h5-14,17-19H,2-4,15-16H2,1H3/b6-5+,8-7+,10-9+,12-11+,14-13+ |
| InChiKey: | InChIKey=UCSSTHOWGCFAPL-QEFDYAAMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.